A4372312
Fmoc-pentafluoro-L-phenylalanine , ≥97% , 205526-32-5
Synonym(s):
(S)-2-(Fmoc-amino)-3-(pentafluorophenyl)propionic acid
CAS NO.：205526-32-5
Empirical Formula: C24H16F5NO4
Molecular Weight: 477.38
MDL number: MFCD00270612
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB208.00 | In Stock |
|
| 500MG | RMB399.20 | In Stock |
|
| 1G | RMB575.20 | In Stock |
|
| 5G | RMB1728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-166° |
| Boiling point: | 602.9±55.0 °C(Predicted) |
| Density | 1.471±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 3.59±0.20(Predicted) |
| color | White to Almost white |
| optical activity | [α]/D -20.5±1.0°, c = 1 in methanol |
| Major Application | peptide synthesis |
| InChIKey | DLOGILOIJKBYKA-KRWDZBQOSA-N |
| SMILES | OC(=O)[C@H](Cc1c(F)c(F)c(F)c(F)c1F)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 205526-32-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P501-P273 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
