A5052012
(<I>S</I>)-<I>N</I>-Fmoc-piperidine-2-carboxylic acid , 97% , 86069-86-5
Synonym(s):
(S)-1-Fmoc-piperidine-2-carboxylic acid;N-Fmoc-L -pipecolinic acid;Fmoc-Pip-OH
CAS NO.:86069-86-5
Empirical Formula: C21H21NO4
Molecular Weight: 351.4
MDL number: MFCD00235898
EINECS: 808-115-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-153 |
| Boiling point: | 561.6±43.0 °C(Predicted) |
| Density | 1.293±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.97±0.20(Predicted) |
| color | White to Light yellow |
| optical activity | [α]22/D 23°, c = 1 in DMF |
| BRN | 4718405 |
| Major Application | peptide synthesis |
| InChI | 1S/C21H21NO4/c23-20(24)19-11-5-6-12-22(19)21(25)26-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18-19H,5-6,11-13H2,(H,23,24)/t19-/m0/s1 |
| InChIKey | CKLAZLINARHOTG-IBGZPJMESA-N |
| SMILES | OC(=O)[C@@H]1CCCCN1C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 86069-86-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







