A4405612
4-Fluoro-2-methylbenzoic Acid , ≥98.0% , 321-21-1
CAS NO.：321-21-1
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD04115880
EINECS: 206-284-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB49.60 | In Stock |
|
| 10g | RMB79.20 | In Stock |
|
| 25G | RMB177.60 | In Stock |
|
| 100G | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-172 °C (lit.) |
| Boiling point: | 265.6±20.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 3.86±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H7FO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | KDXOONIQRUZGSY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1C |
| CAS DataBase Reference | 321-21-1(CAS DataBase Reference) |
Description and Uses
4-Fluoro-2-methylbenzoic acid can be used in the production of medicines, dye carriers, plasticizers, fragrances and food preservatives.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
