A4495212
Fmoc-tranexamic acid , 95% , 167690-53-1
Synonym(s):
N-Fmoc-tranexamic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 200MG | RMB44.00 | In Stock |
|
| 5G | RMB175.20 | In Stock |
|
| 25G | RMB776.80 | In Stock |
|
| 100G | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188 °C |
| Boiling point: | 604.9±28.0 °C(Predicted) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 4.85±0.10(Predicted) |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | 1S/C23H25NO4/c25-22(26)16-11-9-15(10-12-16)13-24-23(27)28-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,15-16,21H,9-14H2,(H,24,27)(H,25,26)/t15-,16- |
| InChIKey | MLMIBGARTUSGND-WKILWMFISA-N |
| SMILES | OC(=O)[C@@H]1CC[C@H](CC1)CNC(=O)OCC2c3ccccc3-c4ccccc24 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
