A4809512
2-Hydroxybenzophenone , >95.0%(GC) , 117-99-7
CAS NO.:117-99-7
Empirical Formula: C13H10O2
Molecular Weight: 198.22
MDL number: MFCD00002216
EINECS: 204-226-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB60.80 | In Stock |
|
| 5G | RMB211.20 | In Stock |
|
| 25G | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39 °C (lit.) |
| Boiling point: | 171-173 °C/12 mmHg (lit.) |
| Density | 1.1184 (rough estimate) |
| refractive index | 1.5954 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,2-8°C |
| pka | 8.07±0.30(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | insoluble |
| BRN | 1638174 |
| InChI | InChI=1S/C13H10O2/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9,14H |
| InChIKey | HJIAMFHSAAEUKR-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1O)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 117-99-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (2-hydroxyphenyl)phenyl-(117-99-7) |
| EPA Substance Registry System | Methanone, (2-hydroxyphenyl)phenyl- (117-99-7) |
Description and Uses
2-Hydroxybenzophenone was used to quantify the metabolites of unmethylated extracts from the supernatants of Pseudomonas acidovorans cultures grown on 1,1-diphenylethylene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29145000 |
| Storage Class | 10 - Combustible liquids |






