PRODUCT Properties
| Melting point: | 292-295 °C (dec.)(lit.) |
| Boiling point: | 364.52°C (rough estimate) |
| Density | 1.1814 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| Flash point: | 283°C |
| storage temp. | 2-8°C, protect from light |
| solubility | ethanol: soluble(lit.) |
| pka | 0.97±0.20(Predicted) |
| form | solid |
| color | Brown |
| Water Solubility | 163ug/L(25 ºC) |
| BRN | 745903 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H9NO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H,15H2 |
| InChIKey | XOGPDSATLSAZEK-UHFFFAOYSA-N |
| SMILES | Nc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| CAS DataBase Reference | 117-79-3(CAS DataBase Reference) |
| IARC | 3 (Vol. 27, Sup 7) 1987 |
| EPA Substance Registry System | 2-Aminoanthraquinone (117-79-3) |
Description and Uses
2-Aminoanthraquinone was used in fabrication of high performance electrode of supercapacitor based on chemically modified graphene hydrogel. It was used in preparation of ordered assemblies of organic and biological molecules on gold(111) surfaces.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H341-H351 |
| Precautionary statements | P201-P202-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P308+P313-P405-P501-P281-P280h |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 36/37/39 |
| WGK Germany | 3 |
| RTECS | CB5120000 |
| TSCA | TSCA listed |
| PackingGroup | II |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
| Hazardous Substances Data | 117-79-3(Hazardous Substances Data) |






