A5484812
2-Mesitylenesulfonyl chloride , 99% , 773-64-8
CAS NO.:773-64-8
Empirical Formula: C9H11ClO2S
Molecular Weight: 218.7
MDL number: MFCD00007434
EINECS: 212-257-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB136.80 | In Stock |
|
| 500G | RMB560.80 | In Stock |
|
| 2.5kg | RMB2660.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-57 °C(lit.) |
| Boiling point: | 150°C/20mm |
| Density | 1.4386 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Soluble in toluene (almost transparency). |
| form | Crystalline Powder |
| color | White to gray |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| BRN | 1107601 |
| InChI | 1S/C9H11ClO2S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5H,1-3H3 |
| InChIKey | PVJZBZSCGJAWNG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(c(C)c1)S(Cl)(=O)=O |
| LogP | 2.738 (est) |
| CAS DataBase Reference | 773-64-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Mesitylenesulfonyl chloride(773-64-8) |
Description and Uses
Coupling reagent in polynucleotide synthesis.1
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-29 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DB8930000 |
| F | 10-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049020 |
| HS Code | 29309070 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





