PRODUCT Properties
| Melting point: | 214-218 °C |
| Boiling point: | 234.5°C (rough estimate) |
| Density | 0.8802 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.99±0.20(Predicted) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | insoluble |
| InChI | InChI=1S/C11H18O/c1-11(12)9-3-7-2-8(5-9)6-10(11)4-7/h7-10,12H,2-6H2,1H3 |
| InChIKey | JKOZWMQUOWYZAB-UHFFFAOYSA-N |
| SMILES | C12CC3CC(CC(C3)C1(C)O)C2 |
| CAS DataBase Reference | 702-98-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Methyl-2-adamantanol(702-98-7) |
Description and Uses
2-Methyl-2-adamantanol is a chemical used in various research applications for the preparation of photoresist compositions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29029090 |
