A6068812
Methyl 4-acetamidosalicylate , 98% , 4093-28-1
CAS NO.：4093-28-1
Empirical Formula: C10H11NO4
Molecular Weight: 209.2
MDL number: MFCD00458326
EINECS: 223-838-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| 100g | RMB245.60 | In Stock |
|
| 500g | RMB1000.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-147° |
| Boiling point: | 405.1±35.0 °C(Predicted) |
| Density | 1.317±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.29±0.10(Predicted) |
| color | Light Orange to Light Brown |
| InChI | InChI=1S/C10H11NO4/c1-6(12)11-7-3-4-8(9(13)5-7)10(14)15-2/h3-5,13H,1-2H3,(H,11,12) |
| InChIKey | LCXHOHRQXZMSQN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(NC(C)=O)C=C1O |
| CAS DataBase Reference | 4093-28-1(CAS DataBase Reference) |
Description and Uses
Methyl 4-Acetamido-2-hydroxybenzoate is a reagent used in the synthesis of Mosapride.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280-P271 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
