A6200912
4-Nitrobenzenesulfonyl Chloride , 98% , 98-74-8
CAS NO.:98-74-8
Empirical Formula: C6H4ClNO4S
Molecular Weight: 221.62
MDL number: MFCD00007445
EINECS: 202-697-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75 °C |
| Boiling point: | 143-144 °C (1.5002 mmHg) |
| Density | 1.602 (estimate) |
| vapor pressure | 0.009Pa at 20℃ |
| refractive index | 1.6000 (estimate) |
| Flash point: | 143-144°C/1.5mm |
| storage temp. | Store below +30°C. |
| solubility | soluble in Toluene |
| form | Powder |
| color | yellow |
| PH | 1 (H2O, 20℃) |
| Water Solubility | Insoluble |
| Sensitive | Moisture Sensitive |
| BRN | 746543 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H4ClNO4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H |
| InChIKey | JXRGUPLJCCDGKG-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(cc1)S(Cl)(=O)=O |
| LogP | 2.1 at 20℃ |
| CAS DataBase Reference | 98-74-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitrobenzenesulphonyl chloride(98-74-8) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 4-nitro- (98-74-8) |
Description and Uses
4-Nitrobenzenesulfonyl chloride was used in the synthesis of
- [Cu(bipy)2Cl](nbs) (1) (bipy = 2,2′-bipyridine, nbs = 4-nitrobenzenesulfonate)
- hydroxylamines of sulfadiazine and sulfamethoxazole
- solution phase peptide using N-nosyl-α-amino acids.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H361f |
| Precautionary statements | P202-P261-P280-P302+P352-P305+P351+P338-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-52/53 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 21 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049085 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Repr. 2 Skin Sens. 1A |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








