A6236612
4-Nitrodiphenylamine , 98% , 836-30-6
CAS NO.：836-30-6
Empirical Formula: C12H10N2O2
Molecular Weight: 214.22
MDL number: MFCD00007301
EINECS: 212-646-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB103.20 | In Stock |
|
| 1G | RMB271.20 | In Stock |
|
| 5G | RMB951.20 | In Stock |
|
| 25g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C (lit.) |
| Boiling point: | 211 °C (30 mmHg) |
| Density | 1.2042 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| Flash point: | 190°C |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -2.60±0.20(Predicted) |
| form | Solid |
| color | Orange to Brown |
| Water Solubility | INSOLUBLE |
| BRN | 2051910 |
| InChI | 1S/C12H10N2O2/c15-14(16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | XXYMSQQCBUKFHE-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Nc2ccccc2)cc1 |
| CAS DataBase Reference | 836-30-6(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(4-Nitrophenyl)-N-phenylamine(836-30-6) |
| EPA Substance Registry System | 4-Nitrodiphenylamine (836-30-6) |
Description and Uses
4-Nitrodiphenylamine was used to study reduction of nitrated diphenylamine derivatives in sediment water batch enrichments and dense cell suspensions of anaerobic, aromatic-compound-mineralizing pure bacterial cultures.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | JJ9600000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 836-30-6(Hazardous Substances Data) |
