A6335330
Canthaxanthin , ≥95.0%(HPLC) , 514-78-3
Synonym(s):
β-Carotin-4,4′-dione;Canthaxanthin (trans);E 161g
CAS NO.:514-78-3
Empirical Formula: C40H52O2
Molecular Weight: 564.85
MDL number: MFCD00016364
EINECS: 208-187-2
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB367.20 | In Stock |
|
| 5mg | RMB817.60 | In Stock |
|
| 25mg | RMB4239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217~218℃ |
| Boiling point: | 717.0±40.0 °C(Predicted) |
| Density | 1.003±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly) |
| form | Solid |
| color | Very Dark Red to Black |
| biological source | synthetic |
| λmax | λ: 465 nm±5 nm Amax |
| Merck | 13,1758 |
| BRN | 1898520 |
| Stability: | Light Sensitive |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | COLORANT |
| InChIKey | FDSDTBUPSURDBL-DKLMTRRASA-N |
| SMILES | CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)CCC1(C)C)\C=C\C=C(C)\C=C\C2=C(C)C(=O)CCC2(C)C |
| LogP | 9.526 (est) |
| CAS DataBase Reference | 514-78-3(CAS DataBase Reference) |
Description and Uses
Antioxidant immune to promote



