A6348612
<i>N</i>-(2-Bromoethyl)phthalimide , >98.0% , 574-98-1
CAS NO.：574-98-1
Empirical Formula: C10H8BrNO2
Molecular Weight: 254.08
MDL number: MFCD00005902
EINECS: 209-379-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB383.20 | In Stock |
|
| 500G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-83 °C (lit.) |
| Boiling point: | 318 °C |
| Density | 1.6254 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -2.35±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to slightly pink or beige |
| Water Solubility | insoluble |
| BRN | 148736 |
| InChI | InChI=1S/C10H8BrNO2/c11-5-6-12-9(13)7-3-1-2-4-8(7)10(12)14/h1-4H,5-6H2 |
| InChIKey | CHZXTOCAICMPQR-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCBr |
| CAS DataBase Reference | 574-98-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(beta-bromoethyl)phthalimide(574-98-1) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(2-bromoethyl)- (574-98-1) |
Description and Uses
N-(2-Bromoethyl)phthalimide is an intermediate used in organic synthesis. It can react with phenyl magnesium bromide to get 2-(2-bromo-ethyl)-3-hydroxy-3-phenyl-isoindolin-1-one.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P260-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29251995 |
