A6644112
Phenyl β-D-glucopyranoside , 98% , 1464-44-4
CAS NO.：1464-44-4
Empirical Formula: C12H16O6
Molecular Weight: 256.25
MDL number: MFCD00064089
EINECS: 215-978-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB373.60 | In Stock |
|
| 25G | RMB1377.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-178 °C(lit.) |
| Boiling point: | 359.49°C (rough estimate) |
| Density | 1.2993 (rough estimate) |
| refractive index | -70.5 ° (C=2, H2O) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly), Water (Slightly, Sonicated) |
| form | Powder |
| pka | 12.70±0.70(Predicted) |
| color | White to Off-white |
| optical activity | [α]25/D 70°, c = 1 in H2O |
| Water Solubility | Soluble in water |
| BRN | 87517 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H16O6/c13-6-8-9(14)10(15)11(16)12(18-8)17-7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | NEZJDVYDSZTRFS-RMPHRYRLSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference | 1464-44-4(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-D-Glucopyranoside, phenyl (1464-44-4) |
Description and Uses
Phenyl β-D-glucopyranoside can be used:
- As a starting material for the synthesis of various derivatives of β-D-glucopyranosides with potential application as anti-HIV agents.
- As a model for glycosides in the gas phase for their spectroscopic investigation.
- As an internal standard in GC and GC-MS quantitative analyses.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,C |
| Safety Statements | 16-26-36/37/39-45-24/25 |
| WGK Germany | 3 |
| RTECS | LZ5985510 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 ipr-mus: 980 mg/kg NYKZAU49,84,53 |
