A6838212
Propionaldehyde 2，4-Dinitrophenylhydrazone , Analysis standard , 725-00-8
Synonym(s):
Propionaldehyde-2,4-dinitrophenylhydrazone;Propionaldehyde-2,4-dinitrophenylhydrazone solution
CAS NO.：725-00-8
Empirical Formula: C9H10N4O4
Molecular Weight: 238.2
MDL number: MFCD00191484
EINECS: 626-468-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-155 °C(lit.) |
| Boiling point: | 391.7±42.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| Flash point: | 2 °C |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | powder or crystals |
| pka | 12.05±0.10(Predicted) |
| color | Dark Orange |
| Major Application | diagnostic assay manufacturing environmental hematology histology |
| InChI | 1S/C9H10N4O4/c1-2-5-10-11-8-4-3-7(12(14)15)6-9(8)13(16)17/h3-6,11H,2H2,1H3/b10-5+ |
| InChIKey | NFQHZOZOFGDSIN-BJMVGYQFSA-N |
| SMILES | CC\C=N\Nc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
Description and Uses
Propionaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke and a breakdown product of lipid peroxidation. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-20/21/22-36-36/37/38 |
| Safety Statements | 16-36/37-36-26 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| HS Code | 2928.00.2500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
