PRODUCT Properties
| Melting point: | 268 °C |
| Boiling point: | 129-130 °C/10 mmHg (lit.) |
| Density | 1.039 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.06 |
| Sensitive | Air Sensitive |
| BRN | 743408 |
| InChI | InChI=1S/C10H12O2/c1-2-7-12-10-5-3-9(8-11)4-6-10/h3-6,8H,2,7H2,1H3 |
| InChIKey | FGXZWMCBNMMYPL-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OCCC)C=C1 |
| CAS DataBase Reference | 5736-85-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 4-propoxy- (5736-85-6) |
Description and Uses
4-Propoxybenzaldehyde was used in the preparation of (2S,4S,5R)-(±)-2-(4-propoxyphenyl)-3,4-dimethyl-5-phenyl-1,3-oxazolidine via condensation with 1-ephedrine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-27-36/37/39 |
| WGK Germany | 3 |
| RTECS | CU7700000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






