A6898012
Pentafluorophenyl Methacrylate (stabilized with MEHQ) , >97.0%(GC) , 13642-97-2
Synonym(s):
Methacrylic acid, pentafluorophenyl ester
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB127.20 | In Stock |
|
| 1G | RMB440.00 | In Stock |
|
| 5G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 56 °C(Press: 3 Torr) |
| Density | 1.394 g/mL at 25 °C |
| refractive index | n20/D1.438 |
| Flash point: | 77℃ |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C10H5F5O2/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15/h1H2,2H3 |
| InChIKey | NIJWSVFNELSKMF-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)C(C)=C |
Description and Uses
The PFP unit acts as an activated ester for coupling (esterification/amidation) reactions. This is also a monomer for low refractive index polymers (n ~1.40).
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P337+P313-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29161400 |
