A6931912
Pentafluorophenyl Acetate , >98.0%(GC) , 19220-93-0
Synonym(s):
Acetic acid pentafluorophenyl ester
CAS NO.:19220-93-0
Empirical Formula: C8H3F5O2
Molecular Weight: 226.1
MDL number: MFCD00015552
EINECS: 242-891-0
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB64.80 | In Stock |
|
| 1G | RMB193.68 | In Stock |
|
| 5G | RMB548.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-30 °C |
| Boiling point: | 59-60 °C12 mm Hg |
| Density | 1.526±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Almost white |
| BRN | 1985849 |
| InChI | 1S/C8H3F5O2/c1-2(14)15-8-6(12)4(10)3(9)5(11)7(8)13/h1H3 |
| InChIKey | ZXTVBLZVILLKPM-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| CAS DataBase Reference | 19220-93-0 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2915.39.2000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






