A7156912
Resorufin , 95% , 635-78-9
Synonym(s):
7-Hydroxy-3H-phenoxazin-3-one-d6
CAS NO.:635-78-9
Empirical Formula: C12H7NO3
Molecular Weight: 213.19
MDL number: MFCD00128991
EINECS: 211-241-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB399.20 | In Stock |
|
| 1G | RMB747.20 | In Stock |
|
| 5G | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 413.0±45.0 °C(Predicted) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility Sparingly soluble in water; soluble in ethanol, N,N-dimethylformamide |
| form | powder |
| pka | 6.6(at 25℃) |
| color | Purple |
| PH Range | Yellow M uorescent (4.4) to orange M uorescent (6.4) |
| λmax | 573nm, 571nm, 585nm, 480nm |
| BRN | 174850 |
| Major Application | Photoelectrochemical cells, electrochromic devices, display device, inks, indicator, oil product detection, dye laser, chemiluminescence detection, cosmetics, fuel cells, cytochrome P 450 assay, multiplex assays, analyzing cells, semen quality, testing prenatal abnormalities, detecting nucleic acids, antitumor agent |
| InChI | 1S/C12H7NO3/c14-7-1-3-9-11(5-7)16-12-6-8(15)2-4-10(12)13-9/h1-6,14H |
| InChIKey | HSSLDCABUXLXKM-UHFFFAOYSA-N |
| SMILES | O=C(C=C1)C=C2C1=NC3=CC=C(O)C=C3O2 |
| CAS DataBase Reference | 635-78-9(CAS DataBase Reference) |
| EPA Substance Registry System | 3H-Phenoxazin-3-one, 7-hydroxy- (635-78-9) |
Description and Uses
Resorufin is a pink fluorescent dye which has been used as a marker for microfilaments in the leading lamella of moving cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| RTECS | SP7698000 |
| TSCA | TSCA listed |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






