LN6297153
98% , 33869-21-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB260.00 | In Stock |
|
| 25g | RMB1243.20 | In Stock |
|
| 100g | RMB4295.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >250°C |
| Boiling point: | 785.7±60.0 °C(Predicted) |
| Density | 1.58±0.1 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | Sparingly soluble in water, ether; soluble in water, ethanol, methanol, amyl alcohol, Hacetone, acetic acid; practically insoluble in chloroform, benzene, petroleum ether |
| pka | 5.31(at 25℃) |
| form | powder |
| color | Black-violet |
| PH Range | Red (4.4) to blue (6.4) |
| Water Solubility | Slightly soluble in water |
| λmax | 611nm |
| Major Application | Electrochromic devices, photosensitive materials, parasiticides, hair dyes, cosmetics, ointment for hemorrhoids |
| InChI | 1S/C24H16N2O6/c25-17-9-23-18(7-15(17)13-3-1-11(27)5-20(13)29)26-19-8-16(22(31)10-24(19)32-23)14-4-2-12(28)6-21(14)30/h1-10,27-30H,25H2 |
| InChIKey | ABNVFGQXCGFSFH-UHFFFAOYSA-N |
| SMILES | Nc1cc2OC3=CC(=O)C(=CC3=Nc2cc1-c4ccc(O)cc4O)c5ccc(O)cc5O |
Description and Uses
Lacmoid is a stain/dye. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
