A7387312
S-(-)-1-(1-Napthalenyl)ethanol , 97% , 15914-84-8
Synonym(s):
(S)-(−)-1-(1-Naphthyl)ethanol
CAS NO.：15914-84-8
Empirical Formula: C12H12O
Molecular Weight: 172.22
MDL number: MFCD00077831
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB140.80 | In Stock |
|
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB1853.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-49 °C(lit.) |
| alpha | -77 º (C=1 IN MEOH) |
| Boiling point: | 165°C/11mmHg(lit.) |
| Density | 1.113±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.29±0.20(Predicted) |
| form | Powder |
| color | Yellow |
| optical activity | [α]20/D 77°, c = 1 in methanol |
| BRN | 2045009 |
| InChI | InChI=1/C12H12O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9,13H,1H3/t9-/s3 |
| InChIKey | CDRQOYRPWJULJN-DJEYLCQNNA-N |
| SMILES | C12C=CC=CC=1C=CC=C2[C@@H](O)C |&1:10,r| |
| CAS DataBase Reference | 15914-84-8(CAS DataBase Reference) |
Description and Uses
(S)?-?1-?(Naphthalen-?1-?yl)?ethanol is a building block used in the synthesis of novel 2,4-diaminoquinazoline derivatives as SMN2 promoter activators for the potential treatment of spinal muscular atrophy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 22-24/25 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29062990 |
