A7583958
OF1 , 10mMinDMSO , 919973-83-4
Synonym(s):
4-Bromo-N-(2,3-dihydro-6-methoxy-1,3-dimethyl-2-oxo-1H-benzimidazol-5-yl)-2-methyl-benzenesulfonamide
CAS NO.：919973-83-4
Empirical Formula: C17H18BrN3O4S
Molecular Weight: 440.31
MDL number: MFCD26964046
EINECS: 604-604-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 573.8±60.0 °C(Predicted) |
| Density | 1.557±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| pka | 9.44±0.20(Predicted) |
| form | powder |
| color | white to beige |
| InChI | InChI=1S/C17H18BrN3O4S/c1-10-7-11(18)5-6-16(10)26(23,24)19-12-8-13-14(9-15(12)25-4)21(3)17(22)20(13)2/h5-9,19H,1-4H3 |
| InChIKey | YUNQZQREIHWDQT-UHFFFAOYSA-N |
| SMILES | C1(S(NC2=C(OC)C=C3N(C)C(=O)N(C)C3=C2)(=O)=O)=CC=C(Br)C=C1C |
Description and Uses
4-Bromo-N-(2,3-dihydro-6-methoxy-1,3-dimethyl-2-oxo-1H-benzimidazol-5-yl)-2-methylbenzenesulfonamide is a selective BRPF2 bromodomain inhibitor.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310+P330-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
