A7607158
ITE , 10mMinDMSO , 448906-42-1
CAS NO.：448906-42-1
Empirical Formula: C14H10N2O3S
Molecular Weight: 286.31
MDL number: MFCD06411597
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234 - 236°C |
| Boiling point: | 520.4±48.0 °C(Predicted) |
| Density | 1.427±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: 30 mg/mL, soluble |
| pka | 14.38±0.30(Predicted) |
| form | solid |
| color | Off-White to Light Yellow |
| InChI | InChI=1S/C14H10N2O3S/c1-19-14(18)11-7-20-13(16-11)12(17)9-6-15-10-5-3-2-4-8(9)10/h2-7,15H,1H3 |
| InChIKey | KDDXOGDIPZSCTM-UHFFFAOYSA-N |
| SMILES | S1C=C(C(OC)=O)N=C1C(C1C2=C(NC=1)C=CC=C2)=O |
Description and Uses
ITE is an endogenous AHR ligand that parenterally or orally induces FoxP3+ Treg that suppress exprimental autoimmune encephalomyelitis. ITE promotes the induction of active immunology tolerance and identifies nontoxic endogenous AHR ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
