A7647512
tert-Butyl α-bromoisobutyrate , 98% , 23877-12-5
Synonym(s):
tert-Butyl 2-bromo-2-methylpropionate
CAS NO.：23877-12-5
Empirical Formula: C8H15BrO2
Molecular Weight: 223.11
MDL number: MFCD00051908
EINECS: 245-924-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB36.00 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 500G | RMB399.20 | In Stock |
|
| 2.5kg | RMB1524.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 35-37°C 1mm |
| Density | 1.196 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 35-37°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform |
| form | Oil |
| color | Clear Colorless |
| Specific Gravity | 1.196 |
| BRN | 1905654 |
| InChI | InChI=1S/C8H15BrO2/c1-7(2,3)11-6(10)8(4,5)9/h1-5H3 |
| InChIKey | IGVNJALYNQVQIT-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)C(Br)(C)C |
| CAS DataBase Reference | 23877-12-5(CAS DataBase Reference) |
Description and Uses
tert-Butyl α-bromoisobutyrate was used as an initiator in the atom transfer radical polymerisation (ATRP) of 2-(acetoacetoxy)ethyl methacrylate (AEMA).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3334 |
| WGK Germany | 2 |
| F | 19 |
| HazardClass | 9 |
| HS Code | 29159000 |
