A7713412
o-Tolidine dihydrochloride , AR,97% , 612-82-8
CAS NO.:612-82-8
Empirical Formula: C14H18Cl2N2
Molecular Weight: 285.21
MDL number: MFCD00012960
EINECS: 210-322-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| color | white to light yellow |
| Water Solubility | Soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C14H16N2.2ClH/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;;/h3-8H,15-16H2,1-2H3;2*1H |
| InChIKey | LUKPNZHXJRJBAN-UHFFFAOYSA-N |
| SMILES | C1(C=CC(N)=C(C)C=1)C1C=CC(N)=C(C)C=1.Cl.Cl |
| CAS DataBase Reference | 612-82-8(CAS DataBase Reference) |
| EPA Substance Registry System | 3,3'-Dimethylbenzidine dihydrochloride (612-82-8) |
Description and Uses
o-Tolidine dihydrochloride is used as a sensitive colorimetric reagent for gold and for free chlorine in water.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H350-H411 |
| Precautionary statements | P280-P301+P312a-P405-P501a-P201-P273-P301+P312+P330-P308+P313-P391-P501 |
| Hazard Codes | T,N |
| Risk Statements | 45-22-51/53-68 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | DD1226000 |
| F | 3-8-9 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29215900 |








