A7755112
Tris(pentafluorophenyl)phosphine , 95% , 1259-35-4
Synonym(s):
Tris(perfluorophenyl)phosphine
CAS NO.：1259-35-4
Empirical Formula: C18F15P
Molecular Weight: 532.14
MDL number: MFCD00079654
EINECS: 215-021-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.00 | In Stock |
|
| 5G | RMB267.20 | In Stock |
|
| 25G | RMB1151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110 °C (lit.) |
| Boiling point: | 343.4±42.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | Insoluble in water. |
| BRN | 773243 |
| InChI | InChI=1S/C18F15P/c19-1-4(22)10(28)16(11(29)5(1)23)34(17-12(30)6(24)2(20)7(25)13(17)31)18-14(32)8(26)3(21)9(27)15(18)33 |
| InChIKey | FQLSDFNKTNBQLC-UHFFFAOYSA-N |
| SMILES | P(C1=C(F)C(F)=C(F)C(F)=C1F)(C1=C(F)C(F)=C(F)C(F)=C1F)C1=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 1259-35-4(CAS DataBase Reference) |
Description and Uses
Tris(pentafluorophenyl)phosphine is an additive for high voltage batteries. It acts as building blocks, coupling reagents, derivatizing reagents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| TSCA | No |
| HS Code | 29319019 |
