BD2435648
(Perfluorophenyl)diphenylphosphine , 98% , 5525-95-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB80.00 | In Stock |
|
| 250mg | RMB125.60 | In Stock |
|
| 1g | RMB324.00 | In Stock |
|
| 5g | RMB1552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-72 °C(lit.) |
| Boiling point: | 353.7±42.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Chloroform |
| form | solid |
| color | White to Almost white |
| InChI | InChI=1S/C18H10F5P/c19-13-14(20)16(22)18(17(23)15(13)21)24(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KUTXTUCJQJPJBH-UHFFFAOYSA-N |
| SMILES | P(C1=C(F)C(F)=C(F)C(F)=C1F)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 5525-95-1(CAS DataBase Reference) |
Description and Uses
The reaction of (pentafluorophenyl)diphenylphosphine with C-ethoxycarbonyl-(p-methoxyphenyl) nitrile imine was used to synthesize [2,3,4,5-tetrafluoro-6-(p- methoxyphenylamino)phenyl]diphenylphosphine oxide whose reduction with trichlorosilane. the reactions of (pentafluorophenyl)diphenylphosphine and bis(penta- fluorophenyl)(phenyl)phosphine with nitrilimines (Housgen 1,3-dipoles) involves two-stage cycloaddi- tion and leads to formation of sufficiently stable fluorophosphoranes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29310099 |






