A7849512
Tetrabutylammonium chloride hydrate , ≥98% , 37451-68-6
Synonym(s):
TBAC hydrate
CAS NO.：37451-68-6
Empirical Formula: C16H38ClNO
Molecular Weight: 295.93
MDL number: MFCD00149970
EINECS: 670-485-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB34.40 | In Stock |
|
| 100G | RMB72.80 | In Stock |
|
| 250g | RMB176.00 | In Stock |
|
| 500G | RMB237.60 | In Stock |
|
| 1kg | RMB400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-44 °C(lit.) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Low Melting Solid |
| color | Off-white |
| Water Solubility | Soluble in cold water. |
| Sensitive | Hygroscopic |
| BRN | 3765327 |
| InChI | InChI=1S/C16H36N.ClH.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;1H;1H2/q+1;;/p-1 |
| InChIKey | FODWRUPJCKASBN-UHFFFAOYSA-M |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[Cl-].O |
| CAS DataBase Reference | 37451-68-6(CAS DataBase Reference) |
Description and Uses
Tetra-n-butylammonium chloride hydrate is used with phosphorus pentoxide for greener deoxychlorination. It is used as a phase transfer catalyst for the preparation of 2-(3-pyridyl)-1-methylpyrrole by the reaction between 3-bromopyridine and 1-methyl-2pyrrolecarboxylic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | Yes |
| HS Code | 29239000 |
