A7869612
2,4,6-Trichlorobenzenesulfonyl Chloride , 98% , 51527-73-2
CAS NO.:51527-73-2
Empirical Formula: C6H2Cl4O2S
Molecular Weight: 279.96
MDL number: MFCD00052973
EINECS: 624-725-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.80 | In Stock |
|
| 5G | RMB137.60 | In Stock |
|
| 25G | RMB372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-48 °C (lit.) |
| Boiling point: | 341.0±42.0 °C(Predicted) |
| Density | 1.728±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Moisture Sensitive |
| BRN | 1534870 |
| InChI | 1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H |
| InChIKey | WHJAQKAAIOHCGN-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 51527-73-2(CAS DataBase Reference) |
Description and Uses
2,4,6-Trichlorobenzenesulfonyl chloride may be used to synthesize 2,4,6-trichlorothiophenol and N-(2-hydroxymethylphenyl)-2,4,6-trichlorobenzenesulfonamide.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,F+ |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







