A7902512
4,4,5,5-Tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane , 98% , 827614-70-0
CAS NO.：827614-70-0
Empirical Formula: C12H14BF3O2
Molecular Weight: 258.04
MDL number: MFCD05663885
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25g | RMB440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 285.0±40.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| refractive index | 1.4520 to 1.4560 |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C12H14BF3O2/c1-11(2)12(3,4)18-13(17-11)7-5-8(14)10(16)9(15)6-7/h5-6H,1-4H3 |
| InChIKey | VFCTUUBAONBDJU-UHFFFAOYSA-N |
| SMILES | O1C(C)(C)C(C)(C)OB1C1=CC(F)=C(F)C(F)=C1 |
| CAS DataBase Reference | 827614-70-0 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2931900090 |
