A7966812
2,3,4,5-Tetrafluorobenzoic Acid , >98.0%(HPLC) , 1201-31-6
CAS NO.:1201-31-6
Empirical Formula: C7H2F4O2
Molecular Weight: 194.08
MDL number: MFCD00009613
EINECS: 601-673-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB209.60 | In Stock |
|
| 500g | RMB640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C (lit.) |
| Boiling point: | 135-137 °C(Press: 23 Torr) |
| Density | 1.5165 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.53±0.10(Predicted) |
| form | Solid |
| color | White |
| BRN | 2052670 |
| InChI | InChI=1S/C7H2F4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H,12,13) |
| InChIKey | SFKRXQKJTIYUAG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 1201-31-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,3,4,5-tetrafluoro- (1201-31-6) |
Description and Uses
2,3,4,5-Tetrafluorobenzoic Acid is used in the synthesis of diterpenoid analogs as antitumor compounds. Also used in the synthesis of novel quinoline lactones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





