A8402112
4-Chloro-2-fluoro-5-nitrotoluene , 98% , 18349-11-6
CAS NO.:18349-11-6
Empirical Formula: C7H5ClFNO2
Molecular Weight: 189.57
MDL number: MFCD00134231
EINECS: 242-225-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1g | RMB44.80 | In Stock |
|
| 5G | RMB176.80 | In Stock |
|
| 25G | RMB605.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-45 °C (lit.) |
| Boiling point: | 264.3±35.0 °C(Predicted) |
| Density | 1.417±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | Crystalline Mass |
| color | Yellow to light brown |
| InChI | 1S/C7H5ClFNO2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,1H3 |
| InChIKey | SJDPAVRCQNFVDM-UHFFFAOYSA-N |
| SMILES | Cc1cc(c(Cl)cc1F)[N+]([O-])=O |
| CAS DataBase Reference | 18349-11-6(CAS DataBase Reference) |
Description and Uses
4-Chloro-2-fluoro-5-nitrotoluene may be used in the synthesis of two new C-11 labeled analogs of N,N-dimethyl-2-(2′-amino-4′-hydroxymethyl-phenylthio)benzylamine, which were further evaluated as serotonin transporter imaging agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![[2,3,5,6-Tetrafluoro-4-(methoxymethyl)phenyl]methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane-carboxylate](https://img.chemicalbook.com/CAS/20150408/GIF/352271-52-4.gif)


