A8449912
Yttrium(III) acetylacetonate hydrate , 99.9%(REO) , 207801-29-4
CAS NO.：207801-29-4
Empirical Formula: C15H23O7Y
Molecular Weight: 404.24
MDL number: MFCD03427495
EINECS: 689-573-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB227.20 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | crystal |
| color | white to yellow |
| Water Solubility | Insoluble in water. |
| InChI | 1S/3C5H8O2.H2O.Y/c3*1-4(6)3-5(2)7;;/h3*3,6H,1-2H3;1H2;/q;;;;+3/p-3/b3*4-3-;; |
| InChIKey | KGNBFQNJCULYHV-KJVLTGTBSA-K |
| SMILES | O.CC(=O)\C=C(\C)O[Y](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
Description and Uses
Yttrium(III) 2,4-pentanedionate hydrate acts as a precursor with europium nitrate and used for the preparation of eurobium-doped yttrium orthovanadate nanoparticles.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H361 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-63 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
