A8454712
Zinc acetylacetonate hydrate , 97% , 108503-47-5
Synonym(s):
Bis(2,4-pentanedionato)zinc;Zn(acac)2
CAS NO.：108503-47-5
Empirical Formula: C10H14O4Zn
Molecular Weight: 263.61
MDL number: MFCD00149060
EINECS: 683-082-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB34.40 | In Stock |
|
| 100G | RMB80.80 | In Stock |
|
| 500G | RMB244.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-138 °C(lit.) |
| Boiling point: | sublimes [HAW93] |
| RTECS | ZH0917500 |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Powder |
| color | white |
| Water Solubility | decomposed by H2O; soluble benzene, acetone [HAW93] |
| Sensitive | Hygroscopic |
| BRN | 4166200 |
| InChI | 1S/2C5H8O2.H2O.Zn/c2*1-4(6)3-5(2)7;;/h2*3,6H,1-2H3;1H2;/q;;;+2/p-2/b2*4-3-;; |
| InChIKey | CYDXJXDAFPJUQE-FDGPNNRMSA-L |
| SMILES | [H]O[H].CC(=O)\C=C(\C)O[Zn]O\C(C)=C/C(C)=O |
Description and Uses
Zinc Acetylacetonate Hydrate is reduced with other complexes at an oil-water interface to synthesize PdPtZn and PdZn nanoparticle (NP) thin films which exhibits higher catalytic activity compared to Pd thin films.Also, it is used in the preparation of high-crystallinity (Zn,Fe)Fe2O4 films as a MOVCD precursor.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H319-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 1 |
| F | 3 |
| TSCA | Yes |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Sens. 1 |
