BD0460732
2,6-Dichloroisonicotinonitrile , 98% , 32710-65-9
CAS NO.：32710-65-9
Empirical Formula: C6H2Cl2N2
Molecular Weight: 173
MDL number: MFCD00173784
EINECS: 604-596-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB25.60 | In Stock |
|
| 1g | RMB73.60 | In Stock |
|
| 5g | RMB246.40 | In Stock |
|
| 10g | RMB454.40 | In Stock |
|
| 25g | RMB1090.40 | In Stock |
|
| 100g | RMB4072.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96 °C |
| Boiling point: | 239.4±35.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -4.76±0.10(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C6H2Cl2N2/c7-5-1-4(3-9)2-6(8)10-5/h1-2H |
| InChIKey | BTUKLHWINORBTN-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC(C#N)=C1 |
| CAS DataBase Reference | 32710-65-9(CAS DataBase Reference) |
Description and Uses
2,6-Dichloroisonicotinonitrile is a pyridine compound with diverse chemical reactivity. It is mainly used as an organic synthesis intermediate and a synthetic raw material for pesticide molecules. It can be used in the preparation of pyridine organic ligands and pesticide molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3439 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
