BD0549553
Methyl3-hydroxy-4-methylbenzoate , 98% , 3556-86-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB70.40 | In Stock |
|
| 1g | RMB183.20 | In Stock |
|
| 5g | RMB649.60 | In Stock |
|
| 25g | RMB1948.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119.0-120.5 °C |
| Boiling point: | 294.6±20.0 °C(Predicted) |
| Density | 1.169±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Acetone (Slightly), Chloroform (Slightly) |
| pka | 9.50±0.10(Predicted) |
| form | Solid |
| color | Tan |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H10O3/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5,10H,1-2H3 |
| InChIKey | GCSINTLJUNXLLU-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C)C(O)=C1 |
| CAS DataBase Reference | 3556-86-3(CAS DataBase Reference) |
Description and Uses
Methyl 4-Methyl-3-hydroxybenzoate is used in the preparation of potent antimalarial agents. Also used in the preparation of aromatic inhibtors of anthranilate synthase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H302-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HazardClass | IRRITANT |
