BD0609753
2-(4-Isobutylphenyl)propanamide , 97% , 59512-17-3
Synonym(s):
α-Methyl-4-(2-methylpropyl)benzeneacetamide;(±)-Ibuprofen amide;(2RS)-2-[4-(2-Methylpropyl)phenyl]propanamide;Ibuprofen impurity C (PhEur)
CAS NO.：59512-17-3
Empirical Formula: C13H19NO
Molecular Weight: 205.3
MDL number: MFCD00454181
EINECS: 261-793-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB388.80 | In Stock |
|
| 1g | RMB1044.80 | In Stock |
|
| 5g | RMB4116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-114 |
| Boiling point: | 356.1±21.0 °C(Predicted) |
| Density | 0.994±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 16.23±0.50(Predicted) |
| color | White |
| BRN | 2448195 |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C13H19NO/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H2,14,15) |
| InChIKey | REUQKCDCQVNKLW-UHFFFAOYSA-N |
| SMILES | CC(C(N)=O)C1=CC=C(CC(C)C)C=C1 |
Description and Uses
An impurity of Ibuprofen (I140000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2924190090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
