BD0707545
3-Cyanobenzoylchloride , 95% , 1711-11-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB82.40 | In Stock |
|
| 1g | RMB205.60 | In Stock |
|
| 5g | RMB711.20 | In Stock |
|
| 10g | RMB1248.00 | In Stock |
|
| 25g | RMB2489.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C (lit.) |
| Boiling point: | 125-129 °C/11 mmHg (lit.) |
| Density | 1.2744 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Mass or Crystalline Powder and Chunks |
| color | White to pale yellow or light gray |
| InChI | InChI=1S/C8H4ClNO/c9-8(11)7-3-1-2-6(4-7)5-10/h1-4H |
| InChIKey | RPESZQVUWMFBEO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC(C#N)=C1 |
Description and Uses
3-Cyanobenzoyl chloride was used in preparation of 3-cyanobenzoyl-glycine methyl ester and 6A,6D-bis[3-(aminomethyl)benzoyl-glycyl-amino]-6A,6D-dideoxy-β-cyclodextrin.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34-20/21/22/34 |
| Safety Statements | 26-27-28-36/37/39-45-26/36/37/39/45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Corr. 1B |
