BD0887732
2,3,4,5-Tetrafluoro-6-nitrobenzoic acid , 98% , 16583-08-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB217.60 | In Stock |
|
| 5g | RMB770.40 | In Stock |
|
| 25g | RMB1910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-141 °C(lit.) |
| Boiling point: | 342.6±42.0 °C(Predicted) |
| Density | 1.7205 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 0.69±0.39(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Green |
| InChI | 1S/C7HF4NO4/c8-2-1(7(13)14)6(12(15)16)5(11)4(10)3(2)9/h(H,13,14) |
| InChIKey | JQGBMYKEWLSLCI-UHFFFAOYSA-N |
| SMILES | OC(=O)c1c(F)c(F)c(F)c(F)c1[N+]([O-])=O |
| CAS DataBase Reference | 16583-08-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






