BD0978232
Methyl 3,5-dibromobenzoate , 98% , 51329-15-8
CAS NO.：51329-15-8
Empirical Formula: C8H6Br2O2
Molecular Weight: 293.94
MDL number: MFCD00082648
EINECS: 610-649-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB36.80 | In Stock |
|
| 10g | RMB48.00 | In Stock |
|
| 25g | RMB116.80 | In Stock |
|
| 100g | RMB459.20 | In Stock |
|
| 500g | RMB2264.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-65°C |
| Boiling point: | 294.2±20.0 °C(Predicted) |
| Density | 1.840±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 2255855 |
| InChI | InChI=1S/C8H6Br2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
| InChIKey | GSMAWUZTAIOCPL-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Br)=CC(Br)=C1 |
| CAS DataBase Reference | 51329-15-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| HS Code | 29163990 |
