BD1197432
N'-Hydroxy-3,5-bis(trifluoromethyl)benzimidamide , 97% , 72111-09-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB69.60 | In Stock |
|
| 5g | RMB264.80 | In Stock |
|
| 25g | RMB1134.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-132 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | 1S/C9H6F6N2O/c10-8(11,12)5-1-4(7(16)17-18)2-6(3-5)9(13,14)15/h1-3,18H,(H2,16,17) |
| InChIKey | GGAPMNUHESBFNK-UHFFFAOYSA-N |
| SMILES | N\C(=N\O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 72111-09-2(CAS DataBase Reference) |
Description and Uses
3,5-Bis(trifluoromethyl)benzamidoxime [N′-hydroxy-3,5-bis(trifluoromethyl)benzenecarboximidamide] is a BAO [3,5-bis(trifluoromethyl)] derivative containing amidoxime as a functional group].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39-45 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2921490090 |
| Storage Class | 13 - Non Combustible Solids |
