BD1412448
Secoisolariciresinol , 98+% , 29388-59-8
Synonym(s):
(2R,3R)-2,3-Bis(4-hydroxy-3-methoxybenzyl)-1,4-butanediol
CAS NO.:29388-59-8
Empirical Formula: C20H26O6
Molecular Weight: 362.42
MDL number: MFCD01075136
EINECS: 249-599-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113 °C |
| Boiling point: | 609.1±55.0 °C(Predicted) |
| Density | 1.251±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 10 mM |
| form | A crystalline solid |
| pka | 9.81±0.20(Predicted) |
| color | White to off-white |
| BRN | 6611290 |
| InChI | 1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | PUETUDUXMCLALY-HOTGVXAUSA-N |
| SMILES | OC[C@@H]([C@H](CO)CC1=CC=C(O)C(OC)=C1)CC2=CC(OC)=C(O)C=C2 |
Description and Uses
Secoisolariciresinol is a Mongolian folk medicine with anti-myocardial ischemia effects. Possesses anti-oxidant and anti-microbial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2909500090 |
| Storage Class | 11 - Combustible Solids |






