BD1468532
Fmoc-D-Tic-OH , 97% , 130309-33-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB109.60 | In Stock |
|
| 10g | RMB212.00 | In Stock |
|
| 25g | RMB515.20 | In Stock |
|
| 100g | RMB1972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-164 °C |
| Boiling point: | 522.37°C (rough estimate) |
| Density | 1.2390 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.82±0.20(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C25H21NO4/c27-24(28)23-13-16-7-1-2-8-17(16)14-26(23)25(29)30-15-22-20-11-5-3-9-18(20)19-10-4-6-12-21(19)22/h1-12,22-23H,13-15H2,(H,27,28)/t23-/m1/s1 |
| InChIKey | LIRBCUNCXDZOOU-HSZRJFAPSA-N |
| SMILES | C1C2=C(C=CC=C2)C[C@H](C(O)=O)N1C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 130309-33-0(CAS DataBase Reference) |
Description and Uses
Fmoc-D-Tic-OH, is an amino acid derivative used in peptide chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
