BD1509532
4-Bromo-3-methylbenzaldehyde , 98% , 78775-11-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB42.40 | In Stock |
|
| 5g | RMB183.20 | In Stock |
|
| 10g | RMB348.80 | In Stock |
|
| 25g | RMB700.00 | In Stock |
|
| 100g | RMB1856.00 | In Stock |
|
| 500g | RMB8156.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116℃ |
| Boiling point: | 262℃ |
| Density | 1.490 |
| Flash point: | 96℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrle (Sparingly), Chloroform (Slightly), DMSO (Sparingly), Methanol (Spar |
| form | Oil |
| color | Colourless to White |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C8H7BrO/c1-6-4-7(5-10)2-3-8(6)9/h2-5H,1H3 |
| InChIKey | YBXGUHGVNUFFJU-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Br)C(C)=C1 |
Description and Uses
4-Bromo-3-methylbenzaldehyde can be involved in determining conformational landscape of σ and π coupling Using para-phenylene and "Aviram-Ratner" bridges. Tetrahydroquinoline derivatives as opioid receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| HS Code | 2913000090 |
