BD2699045
2,6-Dichlorophenolindophenolsodiumsaltxhydrate , 95%(contains=<11%H2O) , 1266615-56-8
Synonym(s):
DCIP;DPIP;2,6-Dichloro-N-(4-hydroxyphenyl)-1,4-benzoquinoneimine sodium salt;2,6-Dichlorobenzenone-indophenol sodium salt;2,6-Dichloroindophenol sodium salt hydrate
CAS NO.:1266615-56-8
Empirical Formula: C12H8Cl2NNaO3
Molecular Weight: 308.09
MDL number: MFCD00150014
EINECS: 210-640-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB113.60 | In Stock |
|
| 5g | RMB388.00 | In Stock |
|
| 25g | RMB1352.00 | In Stock |
|
| 100g | RMB3400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 277 °C (dec.)(lit.) |
| storage temp. | room temp |
| solubility | H2O: soluble10mg/mL, clear, blue to very deep blue |
| form | Powder |
| color | Red to brown |
| Water Solubility | H2O: soluble 10mg/mL, clear, blue to very deep blue |
| λmax | 605 nm |
| BRN | 3641229 |
| Major Application | diagnostic assay manufacturing food and beverages hematology histology |
| InChI | 1S/C12H7Cl2NO2.Na.H2O/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7;;/h1-6,16H;;1H2/q;+1;/p-1 |
| InChIKey | XHSOLXWCGCVQHE-UHFFFAOYSA-M |
| SMILES | O.[Na+].[O-]c1ccc(cc1)\N=C2/C=C(Cl)C(=O)C(Cl)=C2 |
Description and Uses
2,6-Dichloroindophenol sodium salt hydrate is suitable for vitamin C determination. It acts as a redox dye to investigate the efficiency of gold nanoparticles (Au-NP) for the enzymatic activity of glucose oxidase. It is also used to compose UVB specific dosimeter and to measure the rate of photosynthesis. It serves as a good reducing agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU5495000 |
| F | 8 |
| Storage Class | 11 - Combustible Solids |







