A3885812
2,6-dichlorophenolindophenol , 97% , 956-48-9
CAS NO.:956-48-9
Empirical Formula: C12H7Cl2NO2
Molecular Weight: 268.1
MDL number: MFCD00066292
EINECS: 213-479-8
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB82.40 | In Stock |
|
| 1g | RMB318.40 | In Stock |
|
| 5G | RMB985.60 | In Stock |
|
| 10g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 393.5±42.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.49±0.30(Predicted) |
| form | Solid |
| color | Dark Blue to Very Dark Blue |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H |
| InChIKey | CCBICDLNWJRFPO-UHFFFAOYSA-N |
| SMILES | C1(=O)C(Cl)=C/C(=N\C2=CC=C(O)C=C2)/C=C1Cl |
| EPA Substance Registry System | 2,6-Dichloroindophenol (956-48-9) |
Description and Uses
2,6-Dichlorophenolindophenol (Technical Grade) is an organic redox dye, and is commonly used to assess ascorbic acid content.





