BD2744645
(1R,3R)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylicacid , 97% , 489446-85-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB398.40 | In Stock |
|
| 250mg | RMB676.80 | In Stock |
|
| 1g | RMB1826.40 | In Stock |
|
| 5g | RMB5479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117.3°C |
| Boiling point: | 382.5±31.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 4.62±0.40(Predicted) |
| color | White to light yellow |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-8-5-4-7(6-8)9(13)14/h7-8H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t7-,8-/m1/s1 |
| InChIKey | RNJQBGXOSAQQDG-HTQZYQBOSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](NC(OC(C)(C)C)=O)C1 |
| CAS DataBase Reference | 489446-85-7 |
Description and Uses
(1R,3R)-N-BOC-1-AMINOCYCLOPENTANE-3-CARBOXYLIC ACID is a synthetic intermediate useful for pharmaceutical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29221985 |






