BD2747645
Dimethylphenylphosphonite , 98% , 2946-61-4
Synonym(s):
Dimethoxyphenylphosphine;Phenyldimethoxyphosphine
CAS NO.:2946-61-4
Empirical Formula: C8H11O2P
Molecular Weight: 170.15
MDL number: MFCD00008352
EINECS: 220-960-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB140.80 | In Stock |
|
| 25g | RMB588.00 | In Stock |
|
| 100g | RMB2056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 77-79°C 7mm |
| Density | 1.072 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 1.072 |
| color | colorless |
| Water Solubility | Miscible with alcohol. Immiscible with water. |
| Sensitive | Air Sensitive |
| BRN | 1073018 |
| InChI | InChI=1S/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | LMZLQYYLELWCCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(P(OC)OC)C=C1 |
| CAS DataBase Reference | 2946-61-4(CAS DataBase Reference) |
Description and Uses
Dimethyl phenylphosphonite is used in the preparation of phenyl-phosphonic acid dimethyl ester. It is used as a precursor for the preparation of dinitrosyltris(dimethyl phenylphosphonite)manganese(I) tetrafluoroborate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931.90.6000 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |






