BD2814845
(2R,4R)-1-(tert-Butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylicacid , 95% , 681128-51-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB116.80 | In Stock |
|
| 250mg | RMB204.80 | In Stock |
|
| 1g | RMB383.20 | In Stock |
|
| 5g | RMB1746.40 | In Stock |
|
| 10g | RMB3139.20 | In Stock |
|
| 25g | RMB6069.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 346.0±42.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.53±0.40(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C10H16FNO4/c1-10(2,3)16-9(15)12-5-6(11)4-7(12)8(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7-/m1/s1 |
| InChIKey | YGWZXQOYEBWUTH-RNFRBKRXSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](F)C[C@@H]1C(O)=O |
| CAS DataBase Reference | 681128-51-8 |
Description and Uses
(2R,4R)-1-Boc-4-fluoro-2-pyrrolidinecarboxylic Acid is an intermediate used to prepare amino acid benzylamide derivatives as thrombin inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |







