BD3078945
2-Nitro-4-(trifluoromethyl)benzene-1-sulfonylchloride , 98% , 837-95-6
CAS NO.:837-95-6
Empirical Formula: C7H3ClF3NO4S
Molecular Weight: 289.62
MDL number: MFCD00013456
EINECS: 625-901-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB90.40 | In Stock |
|
| 1g | RMB260.00 | In Stock |
|
| 5g | RMB828.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C (lit.) |
| Boiling point: | 325.1±42.0 °C(Predicted) |
| Density | 1.689±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| color | Off-white |
| Sensitive | Lachrymatory |
| BRN | 2663805 |
| InChI | 1S/C7H3ClF3NO4S/c8-17(15,16)6-2-1-4(7(9,10)11)3-5(6)12(13)14/h1-3H |
| InChIKey | KXEMVGQZZLRLBE-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(ccc1S(Cl)(=O)=O)C(F)(F)F |
| CAS DataBase Reference | 837-95-6(CAS DataBase Reference) |
Description and Uses
2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






![2-Nitrophenylsulfenyl Chloride [<i>N</i>-Protecting Agent for Peptides Research]](https://img.chemicalbook.com/CAS/GIF/7669-54-7.gif)

